No history yet

Bounding Volume Hierarchies

Bounding Volume Hierarchies

Imagine you need to find a specific book in a massive, disorganized library. You'd have to check every single book, one by one. Now, what if the library was organized into sections, then shelves, then alphabetized groups? You could quickly narrow down your search. Bounding Volume Hierarchies (BVH) apply this same logic to computer graphics.

A BVH is a tree structure that groups objects in a scene. Each node in the tree represents a bounding volume, a simple shape like a box or sphere that completely encloses a set of objects. The top of the tree, the root node, is a large box containing every object in the scene. This box is then split into smaller boxes, which are split again, and so on, until you reach the leaf nodes, which typically contain just one or a few objects.

Building the Hierarchy

How is a BVH constructed? There are three main approaches.

The most common method is top-down. You start with a single bounding volume around all objects. Then, you recursively split the set of objects into two smaller subsets and create new bounding volumes for each. This continues until each volume contains only a small number of objects. A simple way to split the objects is to find the longest axis of the parent bounding box and partition the objects around the midpoint of that axis.

Less common is the bottom-up approach. Here, you start with each object in its own bounding volume. Then, you progressively merge the two closest volumes into a new, larger volume. This process repeats until only one volume, the root, remains.

Finally, insertion methods are used for dynamic scenes where objects are added or moved. Instead of rebuilding the entire tree, an object is inserted into the existing hierarchy by finding the best leaf node to place it in and then updating the bounding volumes back up to the root.

Making it Faster with SAH

A good BVH is one that minimizes the number of intersection tests. Simply splitting a box down the middle isn't always the best strategy. What if one side of the split gets 99% of the objects and the other gets 1%? That's not a very balanced or efficient tree.

To build better trees, we can use the Surface Area Heuristic (SAH). SAH is a model that estimates the "cost" of a particular split. The goal is to choose the split that results in the lowest cost. The cost function considers both the probability of a ray hitting a child's bounding box and the number of objects within it.

C(N)=CT+pAC(NA)+pBC(NB)C(N) = C_{T} + p_A C(N_A) + p_B C(N_B)

By evaluating the SAH cost for many potential splits (not just the midpoint), we can find a near-optimal split that balances the tree more effectively. This leads to a BVH that can be traversed much more quickly, significantly speeding up rendering.

BVH in Action

The primary applications for BVHs are in ray tracing and collision detection, two fundamental problems in computer graphics and physics simulation.

To accelerate the rendering pipeline, we used a technique called Bounding Volume Hierarchy (BVH), where we partition objects spatially into different bounding boxes.

In ray tracing, an algorithm simulates light by tracing the path of a ray through a scene. A naive approach would be to test if the ray intersects every single triangle in the scene, which is incredibly slow for complex models. With a BVH, you first test the ray against the root bounding box. If it misses, you're done. If it hits, you then test the ray against its children. You only proceed down the branches of the tree that the ray actually intersects. This prunes away massive parts of the scene, allowing for millions of ray-object intersection tests to be skipped.

Collision detection works similarly. To check if two complex objects are colliding, you can first check if their top-level bounding volumes intersect. If they don't, the objects can't possibly be colliding. If they do, you move down their respective BVH trees, checking for intersections between smaller and smaller bounding volumes until you either find a pair of non-intersecting volumes or you need to check the actual geometry of the objects.

Lesson image

Modern graphics cards and rendering engines rely heavily on BVHs. Hardware-accelerated ray tracing, a feature of modern GPUs, often involves dedicated hardware for building and traversing BVHs at incredible speeds. This efficiency is what makes real-time ray tracing in video games and interactive applications possible.

Quiz Questions 1/5

What is the primary purpose of a Bounding Volume Hierarchy (BVH) in computer graphics?

Quiz Questions 2/5

Imagine a BVH is being constructed for a static scene with a million objects. Which construction approach is most commonly used for this scenario?

By organizing geometry into a smart hierarchy, BVHs turn computationally impossible problems into manageable ones, forming a core pillar of modern computer graphics.